C16H18F6N2O3 — CID 157344760
N-[4-(dimethylamino)phenyl]-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157344760) has the molecular formula C16H18F6N2O3 and a molecular weight of 400.32 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157344760 |
| Molecular Formula | C16H18F6N2O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CC(C)C(=O)Nc1ccc(N(C)C)cc1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18N2O.C4F6O2/c1-9(2)12(15)13-10-5-7-11(8-6-10)14(3)4;5-3(6,7)1(11)2(12)4(8,9)10/h5-9H,1-4H3,(H,13,15); |
| InChIKey | BGUZPEQHFDTSAB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|