C20H22F4N4O2 — CID 4195596
N,N'-bis[4-(dimethylamino)phenyl]-2,2,3,3-tetrafluorobutanediamide (PubChem CID 4195596) has the molecular formula C20H22F4N4O2 and a molecular weight of 426.41 g/mol. Its IUPAC name is N,N'-bis[4-(dimethylamino)phenyl]-2,2,3,3-tetrafluorobutanediamide.
| Compound Name | N,N'-bis[4-(dimethylamino)phenyl]-2,2,3,3-tetrafluorobutanediamide |
|---|---|
| PubChem CID | 4195596 |
| Molecular Formula | C20H22F4N4O2 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N,N'-bis[4-(dimethylamino)phenyl]-2,2,3,3-tetrafluorobutanediamide |
| SMILES | CN(C)c1ccc(NC(=O)C(F)(F)C(F)(F)C(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22F4N4O2/c1-27(2)15-9-5-13(6-10-15)25-17(29)19(21,22)20(23,24)18(30)26-14-7-11-16(12-8-14)28(3)4/h5-12H,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | FBNHUGISUVZNPM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|