C17H27N3O2 — CID 108965752
N'-[4-(dimethylamino)phenyl]-N,N-diethyl-2,2-dimethylpropanediamide (PubChem CID 108965752) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N'-[4-(dimethylamino)phenyl]-N,N-diethyl-2,2-dimethylpropanediamide.
| Compound Name | N'-[4-(dimethylamino)phenyl]-N,N-diethyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965752 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N'-[4-(dimethylamino)phenyl]-N,N-diethyl-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)C(=O)C(C)(C)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-7-20(8-2)16(22)17(3,4)15(21)18-13-9-11-14(12-10-13)19(5)6/h9-12H,7-8H2,1-6H3,(H,18,21) |
| InChIKey | HMINIFMAZSXRFI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|