C18H22N2OS — CID 1255894
(2S)-N-[4-(dimethylamino)phenyl]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 1255894) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is (2S)-N-[4-(dimethylamino)phenyl]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[4-(dimethylamino)phenyl]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 1255894 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2S)-N-[4-(dimethylamino)phenyl]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H22N2OS/c1-13-5-11-17(12-6-13)22-14(2)18(21)19-15-7-9-16(10-8-15)20(3)4/h5-12,14H,1-4H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | MKFNNFDTSVYVJV-AWEZNQCLSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|