C24H22N2O4S — CID 22780080
4-[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 22780080) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 22780080 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-[2-[4-[(4-methylbenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(SC(C)C(=O)Nc3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-15-3-5-17(6-4-15)23(28)26-20-11-13-21(14-12-20)31-16(2)22(27)25-19-9-7-18(8-10-19)24(29)30/h3-14,16H,1-2H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | JCQVFBBHVHGRLU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |