C24H21FN2O3S — CID 22780471
N-[4-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide (PubChem CID 22780471) has the molecular formula C24H21FN2O3S and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[4-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 22780471 |
| Molecular Formula | C24H21FN2O3S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-[4-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-fluorobenzamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)Sc2ccc(NC(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H21FN2O3S/c1-15(28)17-5-9-20(10-6-17)26-23(29)16(2)31-22-13-11-21(12-14-22)27-24(30)18-3-7-19(25)8-4-18/h3-14,16H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | JRJOLNKRUWSONI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |