C24H22FN3O4S — CID 60538187
4-fluoro-N-[4-[1-[2-(4-nitrophenyl)sulfanylpropanoylamino]ethyl]phenyl]benzamide (PubChem CID 60538187) has the molecular formula C24H22FN3O4S and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-fluoro-N-[4-[1-[2-(4-nitrophenyl)sulfanylpropanoylamino]ethyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[1-[2-(4-nitrophenyl)sulfanylpropanoylamino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 60538187 |
| Molecular Formula | C24H22FN3O4S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-fluoro-N-[4-[1-[2-(4-nitrophenyl)sulfanylpropanoylamino]ethyl]phenyl]benzamide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)NC(C)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H22FN3O4S/c1-15(26-23(29)16(2)33-22-13-11-21(12-14-22)28(31)32)17-5-9-20(10-6-17)27-24(30)18-3-7-19(25)8-4-18/h3-16H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | QJFVBXCEIUFAIQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|