C24H21N3O6S — CID 23097788
methyl 2-[2-[4-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 23097788) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is methyl 2-[2-[4-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | methyl 2-[2-[4-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 23097788 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | methyl 2-[2-[4-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H21N3O6S/c1-15(22(28)26-21-6-4-3-5-20(21)24(30)33-2)34-19-13-9-17(10-14-19)25-23(29)16-7-11-18(12-8-16)27(31)32/h3-15H,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | SYSZFOXKUQOLJP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|