C22H17Cl2N3O4S — CID 23099046
N-[4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 23099046) has the molecular formula C22H17Cl2N3O4S and a molecular weight of 490.37 g/mol. Its IUPAC name is N-[4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23099046 |
| Molecular Formula | C22H17Cl2N3O4S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | N-[4-[1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | CC(Sc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl2N3O4S/c1-13(21(28)26-20-11-4-15(23)12-19(20)24)32-18-9-5-16(6-10-18)25-22(29)14-2-7-17(8-3-14)27(30)31/h2-13H,1H3,(H,25,29)(H,26,28) |
| InChIKey | JIWSRVUUQJNIFD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|