C16H16N4O4S — CID 46518680
N-[4-(carbamoylamino)phenyl]-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 46518680) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-2-(4-nitrophenyl)sulfanylpropanamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-2-(4-nitrophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 46518680 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C16H16N4O4S/c1-10(25-14-8-6-13(7-9-14)20(23)24)15(21)18-11-2-4-12(5-3-11)19-16(17)22/h2-10H,1H3,(H,18,21)(H3,17,19,22) |
| InChIKey | GRQLEWZKMYZFCJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|