C22H20N4O4S — CID 46553499
2-(4-nitrophenyl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide (PubChem CID 46553499) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 46553499 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c1-15(31-20-13-11-19(12-14-20)26(29)30)21(27)23-17-7-9-18(10-8-17)25-22(28)24-16-5-3-2-4-6-16/h2-15H,1H3,(H,23,27)(H2,24,25,28) |
| InChIKey | HBOBMEZCLYFYRX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|