C17H18N4O5S — CID 9308962
(2S)-N-[2-(4-nitroanilino)ethyl]-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 9308962) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is (2S)-N-[2-(4-nitroanilino)ethyl]-2-(4-nitrophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[2-(4-nitroanilino)ethyl]-2-(4-nitrophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 9308962 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2S)-N-[2-(4-nitroanilino)ethyl]-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N4O5S/c1-12(27-16-8-6-15(7-9-16)21(25)26)17(22)19-11-10-18-13-2-4-14(5-3-13)20(23)24/h2-9,12,18H,10-11H2,1H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | GMSMASITEIHWHP-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|