C12H18N4O4 — CID 120983952
2-amino-3-methoxy-N-[2-(4-nitroanilino)ethyl]propanamide (PubChem CID 120983952) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[2-(4-nitroanilino)ethyl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[2-(4-nitroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 120983952 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-amino-3-methoxy-N-[2-(4-nitroanilino)ethyl]propanamide |
| SMILES | COCC(N)C(=O)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N4O4/c1-20-8-11(13)12(17)15-7-6-14-9-2-4-10(5-3-9)16(18)19/h2-5,11,14H,6-8,13H2,1H3,(H,15,17) |
| InChIKey | GMXKVODRPVJOFV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|