C20H17FN2O3S2 — CID 55389482
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 55389482) has the molecular formula C20H17FN2O3S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(4-nitrophenyl)sulfanylpropanamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(4-nitrophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 55389482 |
| Molecular Formula | C20H17FN2O3S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C20H17FN2O3S2/c1-13(28-17-10-8-16(9-11-17)23(25)26)20(24)22-19(18-3-2-12-27-18)14-4-6-15(21)7-5-14/h2-13,19H,1H3,(H,22,24) |
| InChIKey | AFNGEJDBTCUEHV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|