C18H18FN3O5S — CID 55376670
2-(4-fluorophenoxy)-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]propanehydrazide (PubChem CID 55376670) has the molecular formula C18H18FN3O5S and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]propanehydrazide.
| Compound Name | 2-(4-fluorophenoxy)-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]propanehydrazide |
|---|---|
| PubChem CID | 55376670 |
| Molecular Formula | C18H18FN3O5S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(4-fluorophenoxy)-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]propanehydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)C(C)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18FN3O5S/c1-11(27-15-7-3-13(19)4-8-15)17(23)20-21-18(24)12(2)28-16-9-5-14(6-10-16)22(25)26/h3-12H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | XMKYVXTXBSGGGY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|