C16H13ClFN3O5 — CID 9091707
2-chloro-N'-[(2S)-2-(4-fluorophenoxy)propanoyl]-4-nitrobenzohydrazide (PubChem CID 9091707) has the molecular formula C16H13ClFN3O5 and a molecular weight of 381.75 g/mol. Its IUPAC name is 2-chloro-N'-[(2S)-2-(4-fluorophenoxy)propanoyl]-4-nitrobenzohydrazide.
| Compound Name | 2-chloro-N'-[(2S)-2-(4-fluorophenoxy)propanoyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9091707 |
| Molecular Formula | C16H13ClFN3O5 |
| Molecular Weight | 381.75 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-chloro-N'-[(2S)-2-(4-fluorophenoxy)propanoyl]-4-nitrobenzohydrazide |
| SMILES | C[C@H](Oc1ccc(F)cc1)C(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H13ClFN3O5/c1-9(26-12-5-2-10(18)3-6-12)15(22)19-20-16(23)13-7-4-11(21(24)25)8-14(13)17/h2-9H,1H3,(H,19,22)(H,20,23)/t9-/m0/s1 |
| InChIKey | ACWANZGQXUKYMW-VIFPVBQESA-N |
| XLogP | 2.62 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|