C23H25ClFN3O6 — CID 55324679
[1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55324679) has the molecular formula C23H25ClFN3O6 and a molecular weight of 493.92 g/mol. Its IUPAC name is [1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55324679 |
| Molecular Formula | C23H25ClFN3O6 |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(OC(=O)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(C)C)C(=O)NC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25ClFN3O6/c1-12(2)20(27-22(30)18-10-9-17(28(32)33)11-19(18)24)23(31)34-14(4)21(29)26-13(3)15-5-7-16(25)8-6-15/h5-14,20H,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | UTYWHPKHQSBWRO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|