C24H24ClN3O4 — CID 112762265
2-chloro-N-[3-methyl-1-(1-naphthalen-2-ylethylamino)-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 112762265) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-(1-naphthalen-2-ylethylamino)-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-(1-naphthalen-2-ylethylamino)-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 112762265 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-(1-naphthalen-2-ylethylamino)-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(NC(=O)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H24ClN3O4/c1-14(2)22(27-23(29)20-11-10-19(28(31)32)13-21(20)25)24(30)26-15(3)17-9-8-16-6-4-5-7-18(16)12-17/h4-15,22H,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | PCXMXJJBCCYGLK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|