C21H24ClN3O4 — CID 74651230
2-chloro-N-[3-methyl-1-oxo-1-(3-propan-2-ylanilino)butan-2-yl]-4-nitrobenzamide (PubChem CID 74651230) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-oxo-1-(3-propan-2-ylanilino)butan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-oxo-1-(3-propan-2-ylanilino)butan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 74651230 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-oxo-1-(3-propan-2-ylanilino)butan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)c1cccc(NC(=O)C(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)C(C)C)c1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-12(2)14-6-5-7-15(10-14)23-21(27)19(13(3)4)24-20(26)17-9-8-16(25(28)29)11-18(17)22/h5-13,19H,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | HNRPXQHSIOAJQT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|