C16H24Cl2N4O4 — CID 119507952
2-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide;hydrochloride (PubChem CID 119507952) has the molecular formula C16H24Cl2N4O4 and a molecular weight of 407.30 g/mol. Its IUPAC name is 2-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide;hydrochloride.
| Compound Name | 2-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119507952 |
| Molecular Formula | C16H24Cl2N4O4 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-chloro-N-[1-[2-(ethylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide;hydrochloride |
| SMILES | CCNCCNC(=O)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(C)C.Cl |
| InChI | InChI=1S/C16H23ClN4O4.ClH/c1-4-18-7-8-19-16(23)14(10(2)3)20-15(22)12-6-5-11(21(24)25)9-13(12)17;/h5-6,9-10,14,18H,4,7-8H2,1-3H3,(H,19,23)(H,20,22);1H |
| InChIKey | XHGUMDIQLOMCND-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|