C17H22ClN3O6 — CID 119249634
3-[[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 119249634) has the molecular formula C17H22ClN3O6 and a molecular weight of 399.83 g/mol. Its IUPAC name is 3-[[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 119249634 |
| Molecular Formula | C17H22ClN3O6 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-[[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)NCC(C)(C)C(=O)O |
| InChI | InChI=1S/C17H22ClN3O6/c1-9(2)13(15(23)19-8-17(3,4)16(24)25)20-14(22)11-6-5-10(21(26)27)7-12(11)18/h5-7,9,13H,8H2,1-4H3,(H,19,23)(H,20,22)(H,24,25) |
| InChIKey | IIFVUVHYVQIGKU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|