C20H21Cl2N3O5 — CID 42908907
2,4-dichloro-N-[1-[[2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 42908907) has the molecular formula C20H21Cl2N3O5 and a molecular weight of 454.31 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[[2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[[2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 42908907 |
| Molecular Formula | C20H21Cl2N3O5 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2,4-dichloro-N-[1-[[2-hydroxy-2-(4-nitrophenyl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCC(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21Cl2N3O5/c1-11(2)18(24-19(27)15-8-5-13(21)9-16(15)22)20(28)23-10-17(26)12-3-6-14(7-4-12)25(29)30/h3-9,11,17-18,26H,10H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | FOHQJDDSOCCGSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|