C19H18Cl2N4O6 — CID 55936923
2-chloro-N-[(2S)-1-[2-(5-chloro-2-hydroxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 55936923) has the molecular formula C19H18Cl2N4O6 and a molecular weight of 469.28 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-[2-(5-chloro-2-hydroxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2S)-1-[2-(5-chloro-2-hydroxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 55936923 |
| Molecular Formula | C19H18Cl2N4O6 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-chloro-N-[(2S)-1-[2-(5-chloro-2-hydroxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)NNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C19H18Cl2N4O6/c1-9(2)16(22-17(27)12-5-4-11(25(30)31)8-14(12)21)19(29)24-23-18(28)13-7-10(20)3-6-15(13)26/h3-9,16,26H,1-2H3,(H,22,27)(H,23,28)(H,24,29)/t16-/m0/s1 |
| InChIKey | GCOKYVJTVFBHQU-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|