C16H19ClN6O4S — CID 56544340
2-chloro-N-[3-methyl-1-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylamino]-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 56544340) has the molecular formula C16H19ClN6O4S and a molecular weight of 426.89 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylamino]-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylamino]-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 56544340 |
| Molecular Formula | C16H19ClN6O4S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylamino]-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)NCc1n[nH]c(=S)n1C |
| InChI | InChI=1S/C16H19ClN6O4S/c1-8(2)13(15(25)18-7-12-20-21-16(28)22(12)3)19-14(24)10-5-4-9(23(26)27)6-11(10)17/h4-6,8,13H,7H2,1-3H3,(H,18,25)(H,19,24)(H,21,28) |
| InChIKey | YQBOYUUCQZRZOS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|