C16H18ClN5O4 — CID 31845013
2-chloro-N-[(2R)-3-methyl-1-[(1-methylpyrazol-3-yl)amino]-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 31845013) has the molecular formula C16H18ClN5O4 and a molecular weight of 379.80 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-3-methyl-1-[(1-methylpyrazol-3-yl)amino]-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2R)-3-methyl-1-[(1-methylpyrazol-3-yl)amino]-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 31845013 |
| Molecular Formula | C16H18ClN5O4 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-chloro-N-[(2R)-3-methyl-1-[(1-methylpyrazol-3-yl)amino]-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C16H18ClN5O4/c1-9(2)14(16(24)18-13-6-7-21(3)20-13)19-15(23)11-5-4-10(22(25)26)8-12(11)17/h4-9,14H,1-3H3,(H,19,23)(H,18,20,24)/t14-/m1/s1 |
| InChIKey | VHBKYGOCRZYNBK-CQSZACIVSA-N |
| XLogP | 2.37 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|