C20H18N2O3 — CID 46178562
2-methyl-N-[(1R)-1-naphthalen-2-ylethyl]-5-nitrobenzamide (PubChem CID 46178562) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-naphthalen-2-ylethyl]-5-nitrobenzamide.
| Compound Name | 2-methyl-N-[(1R)-1-naphthalen-2-ylethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 46178562 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-methyl-N-[(1R)-1-naphthalen-2-ylethyl]-5-nitrobenzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(=O)N[C@H](C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18N2O3/c1-13-7-10-18(22(24)25)12-19(13)20(23)21-14(2)16-9-8-15-5-3-4-6-17(15)11-16/h3-12,14H,1-2H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | NTYWGBZTZBGFHT-CQSZACIVSA-N |
| XLogP | 4.55 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|