C21H21NO — CID 43011349
2,4-dimethyl-N-(1-naphthalen-2-ylethyl)benzamide (PubChem CID 43011349) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is 2,4-dimethyl-N-(1-naphthalen-2-ylethyl)benzamide.
| Compound Name | 2,4-dimethyl-N-(1-naphthalen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 43011349 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2,4-dimethyl-N-(1-naphthalen-2-ylethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NC(C)c2ccc3ccccc3c2)c(C)c1 |
| InChI | InChI=1S/C21H21NO/c1-14-8-11-20(15(2)12-14)21(23)22-16(3)18-10-9-17-6-4-5-7-19(17)13-18/h4-13,16H,1-3H3,(H,22,23) |
| InChIKey | KTHCZLSDJSAOPJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |