C16H18ClN7O5 — CID 55927048
(4,6-diamino-1,3,5-triazin-2-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55927048) has the molecular formula C16H18ClN7O5 and a molecular weight of 423.82 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55927048 |
| Molecular Formula | C16H18ClN7O5 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C16H18ClN7O5/c1-7(2)12(14(26)29-6-11-20-15(18)23-16(19)21-11)22-13(25)9-4-3-8(24(27)28)5-10(9)17/h3-5,7,12H,6H2,1-2H3,(H,22,25)(H4,18,19,20,21,23)/t12-/m0/s1 |
| InChIKey | XODLBBRMWWIMLY-LBPRGKRZSA-N |
| XLogP | 1.10 |
| TPSA | 189.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|