C17H19ClN4O6 — CID 55941367
1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55941367) has the molecular formula C17H19ClN4O6 and a molecular weight of 410.81 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | 1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55941367 |
| Molecular Formula | C17H19ClN4O6 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | Cc1noc(C(C)OC(=O)[C@@H](NC(=O)c2ccc([N+](=O)[O-])cc2Cl)C(C)C)n1 |
| InChI | InChI=1S/C17H19ClN4O6/c1-8(2)14(17(24)27-9(3)16-19-10(4)21-28-16)20-15(23)12-6-5-11(22(25)26)7-13(12)18/h5-9,14H,1-4H3,(H,20,23)/t9?,14-/m0/s1 |
| InChIKey | HLRWALSDEMLGPM-RJSPSEDBSA-N |
| XLogP | 3.00 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|