C22H20ClN3O6 — CID 37142725
(3-phenyl-1,2-oxazol-5-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 37142725) has the molecular formula C22H20ClN3O6 and a molecular weight of 457.87 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 37142725 |
| Molecular Formula | C22H20ClN3O6 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C22H20ClN3O6/c1-13(2)20(24-21(27)17-9-8-15(26(29)30)10-18(17)23)22(28)31-12-16-11-19(25-32-16)14-6-4-3-5-7-14/h3-11,13,20H,12H2,1-2H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | COMIVVKDUZFBPC-FQEVSTJZSA-N |
| XLogP | 4.40 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|