C20H23ClN4O6S — CID 55928509
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55928509) has the molecular formula C20H23ClN4O6S and a molecular weight of 482.95 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55928509 |
| Molecular Formula | C20H23ClN4O6S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CCN(C(C)=O)c1nc(COC(=O)[C@@H](NC(=O)c2ccc([N+](=O)[O-])cc2Cl)C(C)C)cs1 |
| InChI | InChI=1S/C20H23ClN4O6S/c1-5-24(12(4)26)20-22-13(10-32-20)9-31-19(28)17(11(2)3)23-18(27)15-7-6-14(25(29)30)8-16(15)21/h6-8,10-11,17H,5,9H2,1-4H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | YYWGNQXYZCTZSV-KRWDZBQOSA-N |
| XLogP | 3.58 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|