C17H17N3O5S — CID 31201445
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 31201445) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 31201445 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | CCN(C(C)=O)c1nc(COC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C17H17N3O5S/c1-3-19(12(2)21)17-18-14(11-26-17)10-25-16(22)9-6-13-4-7-15(8-5-13)20(23)24/h4-9,11H,3,10H2,1-2H3/b9-6+ |
| InChIKey | XGZDDKSGUZFISY-RMKNXTFCSA-N |
| XLogP | 3.18 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|