C17H16N4O5S2 — CID 175018579
ethyl 2-[2-[carbamothioyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 175018579) has the molecular formula C17H16N4O5S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl 2-[2-[carbamothioyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[carbamothioyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 175018579 |
| Molecular Formula | C17H16N4O5S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | ethyl 2-[2-[carbamothioyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(N(C(=O)C=Cc2ccc([N+](=O)[O-])cc2)C(N)=S)n1 |
| InChI | InChI=1S/C17H16N4O5S2/c1-2-26-15(23)9-12-10-28-17(19-12)20(16(18)27)14(22)8-5-11-3-6-13(7-4-11)21(24)25/h3-8,10H,2,9H2,1H3,(H2,18,27) |
| InChIKey | PBXFAIOBKDMMIE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|