C14H15FN2O2S — CID 80575049
ethyl 2-[2-(4-fluoro-N-methylanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 80575049) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl 2-[2-(4-fluoro-N-methylanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(4-fluoro-N-methylanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80575049 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl 2-[2-(4-fluoro-N-methylanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(N(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-3-19-13(18)8-11-9-20-14(16-11)17(2)12-6-4-10(15)5-7-12/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | NKIYYIDQFMITEO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |