C13H11F2NO2S — CID 78990286
ethyl 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 78990286) has the molecular formula C13H11F2NO2S and a molecular weight of 283.30 g/mol. Its IUPAC name is ethyl 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 78990286 |
| Molecular Formula | C13H11F2NO2S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | ethyl 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H11F2NO2S/c1-2-18-12(17)6-9-7-19-13(16-9)8-3-4-10(14)11(15)5-8/h3-5,7H,2,6H2,1H3 |
| InChIKey | TUIALLVNIHSELL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |