C14H12F3NO2S — CID 80573515
ethyl 2-[2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetate (PubChem CID 80573515) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is ethyl 2-[2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80573515 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | ethyl 2-[2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F3NO2S/c1-2-20-12(19)7-9-8-21-13(18-9)10-5-3-4-6-11(10)14(15,16)17/h3-6,8H,2,7H2,1H3 |
| InChIKey | GDCHFXAEXAJZLL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |