C13H11ClFNO2S — CID 80574224
ethyl 2-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 80574224) has the molecular formula C13H11ClFNO2S and a molecular weight of 299.75 g/mol. Its IUPAC name is ethyl 2-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80574224 |
| Molecular Formula | C13H11ClFNO2S |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | ethyl 2-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(-c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C13H11ClFNO2S/c1-2-18-11(17)6-8-7-19-13(16-8)12-9(14)4-3-5-10(12)15/h3-5,7H,2,6H2,1H3 |
| InChIKey | VPJSOSHWNIJXHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |