C11H7ClFNOS — CID 64542794
1-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 64542794) has the molecular formula C11H7ClFNOS and a molecular weight of 255.70 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 64542794 |
| Molecular Formula | C11H7ClFNOS |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(-c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C11H7ClFNOS/c1-6(15)9-5-16-11(14-9)10-7(12)3-2-4-8(10)13/h2-5H,1H3 |
| InChIKey | CHZSIINHYJTZNI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |