C9H4ClF2NS — CID 83158211
4-chloro-2-(2,6-difluorophenyl)-1,3-thiazole (PubChem CID 83158211) has the molecular formula C9H4ClF2NS and a molecular weight of 231.65 g/mol. Its IUPAC name is 4-chloro-2-(2,6-difluorophenyl)-1,3-thiazole.
| Compound Name | 4-chloro-2-(2,6-difluorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83158211 |
| Molecular Formula | C9H4ClF2NS |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | 4-chloro-2-(2,6-difluorophenyl)-1,3-thiazole |
| SMILES | Fc1cccc(F)c1-c1nc(Cl)cs1 |
| InChI | InChI=1S/C9H4ClF2NS/c10-7-4-14-9(13-7)8-5(11)2-1-3-6(8)12/h1-4H |
| InChIKey | SWRXSIIBXWTKHT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |