C12H11NOS — CID 64543607
1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 64543607) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 64543607 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C12H11NOS/c1-8-4-3-5-10(6-8)12-13-11(7-15-12)9(2)14/h3-7H,1-2H3 |
| InChIKey | KATOAISEZAOBSJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |