C10H7NO3S — CID 43140162
2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 43140162) has the molecular formula C10H7NO3S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43140162 |
| Molecular Formula | C10H7NO3S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C10H7NO3S/c12-7-3-1-2-6(4-7)9-11-8(5-15-9)10(13)14/h1-5,12H,(H,13,14) |
| InChIKey | PJBROFATYWROMQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |