C16H18N2O4S — CID 22687524
2-[3-(2-morpholin-4-ylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 22687524) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[3-(2-morpholin-4-ylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(2-morpholin-4-ylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 22687524 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[3-(2-morpholin-4-ylethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2cccc(OCCN3CCOCC3)c2)n1 |
| InChI | InChI=1S/C16H18N2O4S/c19-16(20)14-11-23-15(17-14)12-2-1-3-13(10-12)22-9-6-18-4-7-21-8-5-18/h1-3,10-11H,4-9H2,(H,19,20) |
| InChIKey | IVDJKPBZCAOJTO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |