C13H15NO2S — CID 66057136
4-(dimethoxymethyl)-2-(3-methylphenyl)-1,3-thiazole (PubChem CID 66057136) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(3-methylphenyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(3-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 66057136 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(3-methylphenyl)-1,3-thiazole |
| SMILES | COC(OC)c1csc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C13H15NO2S/c1-9-5-4-6-10(7-9)12-14-11(8-17-12)13(15-2)16-3/h4-8,13H,1-3H3 |
| InChIKey | HZZYTDYFCVFNEV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|