C12H13NO3S — CID 136889074
4-[4-(dimethoxymethyl)-1,3-thiazol-2-yl]phenol (PubChem CID 136889074) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-[4-(dimethoxymethyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 4-[4-(dimethoxymethyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 136889074 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-[4-(dimethoxymethyl)-1,3-thiazol-2-yl]phenol |
| SMILES | COC(OC)c1csc(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H13NO3S/c1-15-12(16-2)10-7-17-11(13-10)8-3-5-9(14)6-4-8/h3-7,12,14H,1-2H3 |
| InChIKey | PDCCUXXPBLBFSK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|