C12H11BrFNO2S — CID 114884550
2-(2-bromo-6-fluorophenyl)-4-(dimethoxymethyl)-1,3-thiazole (PubChem CID 114884550) has the molecular formula C12H11BrFNO2S and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(2-bromo-6-fluorophenyl)-4-(dimethoxymethyl)-1,3-thiazole.
| Compound Name | 2-(2-bromo-6-fluorophenyl)-4-(dimethoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 114884550 |
| Molecular Formula | C12H11BrFNO2S |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 2-(2-bromo-6-fluorophenyl)-4-(dimethoxymethyl)-1,3-thiazole |
| SMILES | COC(OC)c1csc(-c2c(F)cccc2Br)n1 |
| InChI | InChI=1S/C12H11BrFNO2S/c1-16-12(17-2)9-6-18-11(15-9)10-7(13)4-3-5-8(10)14/h3-6,12H,1-2H3 |
| InChIKey | OBUDFCNKSUEXCU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|