C13H14FNO3S — CID 114016215
4-(dimethoxymethyl)-2-(4-fluoro-3-methoxyphenyl)-1,3-thiazole (PubChem CID 114016215) has the molecular formula C13H14FNO3S and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(4-fluoro-3-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(4-fluoro-3-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 114016215 |
| Molecular Formula | C13H14FNO3S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(4-fluoro-3-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1cc(-c2nc(C(OC)OC)cs2)ccc1F |
| InChI | InChI=1S/C13H14FNO3S/c1-16-11-6-8(4-5-9(11)14)12-15-10(7-19-12)13(17-2)18-3/h4-7,13H,1-3H3 |
| InChIKey | PAXWMJSTFHSJNB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|