C11H6BrClFNOS — CID 114884533
1-[2-(2-bromo-6-fluorophenyl)-1,3-thiazol-4-yl]-2-chloroethanone (PubChem CID 114884533) has the molecular formula C11H6BrClFNOS and a molecular weight of 334.60 g/mol. Its IUPAC name is 1-[2-(2-bromo-6-fluorophenyl)-1,3-thiazol-4-yl]-2-chloroethanone.
| Compound Name | 1-[2-(2-bromo-6-fluorophenyl)-1,3-thiazol-4-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 114884533 |
| Molecular Formula | C11H6BrClFNOS |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 1-[2-(2-bromo-6-fluorophenyl)-1,3-thiazol-4-yl]-2-chloroethanone |
| SMILES | O=C(CCl)c1csc(-c2c(F)cccc2Br)n1 |
| InChI | InChI=1S/C11H6BrClFNOS/c12-6-2-1-3-7(14)10(6)11-15-8(5-17-11)9(16)4-13/h1-3,5H,4H2 |
| InChIKey | GHCMGQBKDQPPDW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|