C10H10N2OS — CID 135741995
4-[4-(aminomethyl)-1,3-thiazol-2-yl]phenol (PubChem CID 135741995) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 4-[4-(aminomethyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 135741995 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4-[4-(aminomethyl)-1,3-thiazol-2-yl]phenol |
| SMILES | NCc1csc(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H10N2OS/c11-5-8-6-14-10(12-8)7-1-3-9(13)4-2-7/h1-4,6,13H,5,11H2 |
| InChIKey | QVQSIXWDPQPVAO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |