C16H19NS — CID 144794797
4-(2,3-dimethylbut-2-enyl)-2-(4-methylphenyl)-1,3-thiazole (PubChem CID 144794797) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is 4-(2,3-dimethylbut-2-enyl)-2-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 4-(2,3-dimethylbut-2-enyl)-2-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 144794797 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-(2,3-dimethylbut-2-enyl)-2-(4-methylphenyl)-1,3-thiazole |
| SMILES | CC(C)=C(C)Cc1csc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C16H19NS/c1-11(2)13(4)9-15-10-18-16(17-15)14-7-5-12(3)6-8-14/h5-8,10H,9H2,1-4H3 |
| InChIKey | YZNFMGRDOCIOSH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|