C21H22N4O2S — CID 78823652
N'-[2-(4-methylanilino)acetyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetohydrazide (PubChem CID 78823652) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N'-[2-(4-methylanilino)acetyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetohydrazide.
| Compound Name | N'-[2-(4-methylanilino)acetyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 78823652 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-[2-(4-methylanilino)acetyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cc2csc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H22N4O2S/c1-14-3-7-16(8-4-14)21-23-18(13-28-21)11-19(26)24-25-20(27)12-22-17-9-5-15(2)6-10-17/h3-10,13,22H,11-12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | NQCNYBQWYVTUMM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|